C17H19N5S — CID 3953347
1-[[1-(4-cyanophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-3-ethylthiourea (PubChem CID 3953347) has the molecular formula C17H19N5S and a molecular weight of 325.44 g/mol. Its IUPAC name is 1-[[1-(4-cyanophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-3-ethylthiourea.
| Compound Name | 1-[[1-(4-cyanophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-3-ethylthiourea |
|---|---|
| PubChem CID | 3953347 |
| Molecular Formula | C17H19N5S |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 1-[[1-(4-cyanophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-3-ethylthiourea |
| SMILES | CCNC(=S)NN=Cc1cc(C)n(-c2ccc(C#N)cc2)c1C |
| InChI | InChI=1S/C17H19N5S/c1-4-19-17(23)21-20-11-15-9-12(2)22(13(15)3)16-7-5-14(10-18)6-8-16/h5-9,11H,4H2,1-3H3,(H2,19,21,23) |
| InChIKey | CENICXKSOIJEAF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 65.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|