C17H24N6S — CID 9145608
1-[(Z)-[2,5-dimethyl-1-(2-propan-2-ylpyrazol-3-yl)pyrrol-3-yl]methylideneamino]-3-prop-2-enylthiourea (PubChem CID 9145608) has the molecular formula C17H24N6S and a molecular weight of 344.49 g/mol. Its IUPAC name is 1-[(Z)-[2,5-dimethyl-1-(2-propan-2-ylpyrazol-3-yl)pyrrol-3-yl]methylideneamino]-3-prop-2-enylthiourea.
| Compound Name | 1-[(Z)-[2,5-dimethyl-1-(2-propan-2-ylpyrazol-3-yl)pyrrol-3-yl]methylideneamino]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 9145608 |
| Molecular Formula | C17H24N6S |
| Molecular Weight | 344.49 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 1-[(Z)-[2,5-dimethyl-1-(2-propan-2-ylpyrazol-3-yl)pyrrol-3-yl]methylideneamino]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)N/N=C\c1cc(C)n(-c2ccnn2C(C)C)c1C |
| InChI | InChI=1S/C17H24N6S/c1-6-8-18-17(24)21-19-11-15-10-13(4)22(14(15)5)16-7-9-20-23(16)12(2)3/h6-7,9-12H,1,8H2,2-5H3,(H2,18,21,24)/b19-11- |
| InChIKey | ZAGARQKXRBGXMW-ODLFYWEKSA-N |
| XLogP | 2.86 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.49 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|