C11H13N3O2S — CID 135717163
1-[(E)-(2,3-dihydroxyphenyl)methylideneamino]-3-prop-2-enylthiourea (PubChem CID 135717163) has the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. Its IUPAC name is 1-[(E)-(2,3-dihydroxyphenyl)methylideneamino]-3-prop-2-enylthiourea.
| Compound Name | 1-[(E)-(2,3-dihydroxyphenyl)methylideneamino]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 135717163 |
| Molecular Formula | C11H13N3O2S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 1-[(E)-(2,3-dihydroxyphenyl)methylideneamino]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)N/N=C/c1cccc(O)c1O |
| InChI | InChI=1S/C11H13N3O2S/c1-2-6-12-11(17)14-13-7-8-4-3-5-9(15)10(8)16/h2-5,7,15-16H,1,6H2,(H2,12,14,17)/b13-7+ |
| InChIKey | CFNOJEAWFLRRIN-NTUHNPAUSA-N |
| XLogP | 1.08 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|