C18H27N3OS — CID 110508310
1-[(E)-(2-heptoxyphenyl)methylideneamino]-3-prop-2-enylthiourea (PubChem CID 110508310) has the molecular formula C18H27N3OS and a molecular weight of 333.50 g/mol. Its IUPAC name is 1-[(E)-(2-heptoxyphenyl)methylideneamino]-3-prop-2-enylthiourea.
| Compound Name | 1-[(E)-(2-heptoxyphenyl)methylideneamino]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 110508310 |
| Molecular Formula | C18H27N3OS |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 1-[(E)-(2-heptoxyphenyl)methylideneamino]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)N/N=C/c1ccccc1OCCCCCCC |
| InChI | InChI=1S/C18H27N3OS/c1-3-5-6-7-10-14-22-17-12-9-8-11-16(17)15-20-21-18(23)19-13-4-2/h4,8-9,11-12,15H,2-3,5-7,10,13-14H2,1H3,(H2,19,21,23)/b20-15+ |
| InChIKey | DIEOGMIANUMBQH-HMMYKYKNSA-N |
| XLogP | 4.02 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|