C21H33N3OS — CID 110534061
1-cyclohexyl-3-[(Z)-(2-heptoxyphenyl)methylideneamino]thiourea (PubChem CID 110534061) has the molecular formula C21H33N3OS and a molecular weight of 375.58 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(Z)-(2-heptoxyphenyl)methylideneamino]thiourea.
| Compound Name | 1-cyclohexyl-3-[(Z)-(2-heptoxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 110534061 |
| Molecular Formula | C21H33N3OS |
| Molecular Weight | 375.58 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | 1-cyclohexyl-3-[(Z)-(2-heptoxyphenyl)methylideneamino]thiourea |
| SMILES | CCCCCCCOc1ccccc1/C=N\NC(=S)NC1CCCCC1 |
| InChI | InChI=1S/C21H33N3OS/c1-2-3-4-5-11-16-25-20-15-10-9-12-18(20)17-22-24-21(26)23-19-13-7-6-8-14-19/h9-10,12,15,17,19H,2-8,11,13-14,16H2,1H3,(H2,23,24,26)/b22-17- |
| InChIKey | NXLOWMCHBMUTOM-XLNRJJMWSA-N |
| XLogP | 5.17 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.58 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|