C28H24ClN4O+ — CID 153386899
4-[3-(2-chloroacetyl)-2,5-dimethylpyrrol-1-yl]-N-[1-(4-cyanophenyl)-2,5-dimethylpyrrol-3-yl]benzonitrilium (PubChem CID 153386899) has the molecular formula C28H24ClN4O+ and a molecular weight of 467.98 g/mol. Its IUPAC name is 4-[3-(2-chloroacetyl)-2,5-dimethylpyrrol-1-yl]-N-[1-(4-cyanophenyl)-2,5-dimethylpyrrol-3-yl]benzonitrilium.
| Compound Name | 4-[3-(2-chloroacetyl)-2,5-dimethylpyrrol-1-yl]-N-[1-(4-cyanophenyl)-2,5-dimethylpyrrol-3-yl]benzonitrilium |
|---|---|
| PubChem CID | 153386899 |
| Molecular Formula | C28H24ClN4O+ |
| Molecular Weight | 467.98 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | 4-[3-(2-chloroacetyl)-2,5-dimethylpyrrol-1-yl]-N-[1-(4-cyanophenyl)-2,5-dimethylpyrrol-3-yl]benzonitrilium |
| SMILES | Cc1cc([N+]#Cc2ccc(-n3c(C)cc(C(=O)CCl)c3C)cc2)c(C)n1-c1ccc(C#N)cc1 |
| InChI | InChI=1S/C28H24ClN4O/c1-18-13-26(28(34)15-29)20(3)32(18)24-11-7-23(8-12-24)17-31-27-14-19(2)33(21(27)4)25-9-5-22(16-30)6-10-25/h5-14H,15H2,1-4H3/q+1 |
| InChIKey | RHHNALQMSHTFIJ-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 55.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.98 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|