C15H16INO — CID 90316003
1-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-2-iodoethanone (PubChem CID 90316003) has the molecular formula C15H16INO and a molecular weight of 353.20 g/mol. Its IUPAC name is 1-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-2-iodoethanone.
| Compound Name | 1-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-2-iodoethanone |
|---|---|
| PubChem CID | 90316003 |
| Molecular Formula | C15H16INO |
| Molecular Weight | 353.20 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | 1-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-2-iodoethanone |
| SMILES | Cc1ccc(-n2c(C)cc(C(=O)CI)c2C)cc1 |
| InChI | InChI=1S/C15H16INO/c1-10-4-6-13(7-5-10)17-11(2)8-14(12(17)3)15(18)9-16/h4-8H,9H2,1-3H3 |
| InChIKey | LABCVDUBJORUOB-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.20 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|