C22H22FNOS — CID 4223293
2-(2,5-dimethylphenyl)sulfanyl-1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]ethanone (PubChem CID 4223293) has the molecular formula C22H22FNOS and a molecular weight of 367.49 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)sulfanyl-1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]ethanone.
| Compound Name | 2-(2,5-dimethylphenyl)sulfanyl-1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 4223293 |
| Molecular Formula | C22H22FNOS |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 2-(2,5-dimethylphenyl)sulfanyl-1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]ethanone |
| SMILES | Cc1ccc(C)c(SCC(=O)c2cc(C)n(-c3ccc(F)cc3)c2C)c1 |
| InChI | InChI=1S/C22H22FNOS/c1-14-5-6-15(2)22(11-14)26-13-21(25)20-12-16(3)24(17(20)4)19-9-7-18(23)8-10-19/h5-12H,13H2,1-4H3 |
| InChIKey | PTGGMPGXKAUIPK-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|