C23H22FN5OS — CID 3463439
2-[1-(2,4-dimethylphenyl)tetrazol-5-yl]sulfanyl-1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]ethanone (PubChem CID 3463439) has the molecular formula C23H22FN5OS and a molecular weight of 435.53 g/mol. Its IUPAC name is 2-[1-(2,4-dimethylphenyl)tetrazol-5-yl]sulfanyl-1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]ethanone.
| Compound Name | 2-[1-(2,4-dimethylphenyl)tetrazol-5-yl]sulfanyl-1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 3463439 |
| Molecular Formula | C23H22FN5OS |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 2-[1-(2,4-dimethylphenyl)tetrazol-5-yl]sulfanyl-1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]ethanone |
| SMILES | Cc1ccc(-n2nnnc2SCC(=O)c2cc(C)n(-c3ccc(F)cc3)c2C)c(C)c1 |
| InChI | InChI=1S/C23H22FN5OS/c1-14-5-10-21(15(2)11-14)29-23(25-26-27-29)31-13-22(30)20-12-16(3)28(17(20)4)19-8-6-18(24)7-9-19/h5-12H,13H2,1-4H3 |
| InChIKey | QQHGXKQNUQNECR-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|