C18H20N2OS2 — CID 110656737
2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)-1-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]ethanone (PubChem CID 110656737) has the molecular formula C18H20N2OS2 and a molecular weight of 344.51 g/mol. Its IUPAC name is 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)-1-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]ethanone.
| Compound Name | 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)-1-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 110656737 |
| Molecular Formula | C18H20N2OS2 |
| Molecular Weight | 344.51 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)-1-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]ethanone |
| SMILES | Cc1ccc(-n2c(C)cc(C(=O)CSC3=NCCS3)c2C)cc1 |
| InChI | InChI=1S/C18H20N2OS2/c1-12-4-6-15(7-5-12)20-13(2)10-16(14(20)3)17(21)11-23-18-19-8-9-22-18/h4-7,10H,8-9,11H2,1-3H3 |
| InChIKey | JCDNGUKRUUNYAF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.51 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|