C30H26N2O2S — CID 3636408
1-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-2-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]ethanone (PubChem CID 3636408) has the molecular formula C30H26N2O2S and a molecular weight of 478.62 g/mol. Its IUPAC name is 1-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-2-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]ethanone.
| Compound Name | 1-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-2-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]ethanone |
|---|---|
| PubChem CID | 3636408 |
| Molecular Formula | C30H26N2O2S |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | 1-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-2-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]ethanone |
| SMILES | Cc1ccc(-n2c(C)cc(C(=O)CSc3nc(-c4ccccc4)c(-c4ccccc4)o3)c2C)cc1 |
| InChI | InChI=1S/C30H26N2O2S/c1-20-14-16-25(17-15-20)32-21(2)18-26(22(32)3)27(33)19-35-30-31-28(23-10-6-4-7-11-23)29(34-30)24-12-8-5-9-13-24/h4-18H,19H2,1-3H3 |
| InChIKey | YFLMRKYTFCAPSV-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|