C22H18F2N2O3S — CID 2125900
2-(1,3-benzoxazol-2-ylsulfanyl)-1-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]ethanone (PubChem CID 2125900) has the molecular formula C22H18F2N2O3S and a molecular weight of 428.46 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-ylsulfanyl)-1-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]ethanone.
| Compound Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-1-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 2125900 |
| Molecular Formula | C22H18F2N2O3S |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-1-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]ethanone |
| SMILES | Cc1cc(C(=O)CSc2nc3ccccc3o2)c(C)n1-c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C22H18F2N2O3S/c1-13-11-17(14(2)26(13)15-7-9-16(10-8-15)28-21(23)24)19(27)12-30-22-25-18-5-3-4-6-20(18)29-22/h3-11,21H,12H2,1-2H3 |
| InChIKey | WTCISMDZGKWNTJ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 57.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|