C22H18F3NO4 — CID 2401469
[2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-fluorobenzoate (PubChem CID 2401469) has the molecular formula C22H18F3NO4 and a molecular weight of 417.38 g/mol. Its IUPAC name is [2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-fluorobenzoate.
| Compound Name | [2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 2401469 |
| Molecular Formula | C22H18F3NO4 |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | [2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-fluorobenzoate |
| SMILES | Cc1cc(C(=O)COC(=O)c2ccccc2F)c(C)n1-c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C22H18F3NO4/c1-13-11-18(20(27)12-29-21(28)17-5-3-4-6-19(17)23)14(2)26(13)15-7-9-16(10-8-15)30-22(24)25/h3-11,22H,12H2,1-2H3 |
| InChIKey | OVWQVLDKLCHSKU-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|