C26H24F2N2O5 — CID 2413421
[2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] (Z)-2-acetamido-3-phenylprop-2-enoate (PubChem CID 2413421) has the molecular formula C26H24F2N2O5 and a molecular weight of 482.48 g/mol. Its IUPAC name is [2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] (Z)-2-acetamido-3-phenylprop-2-enoate.
| Compound Name | [2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] (Z)-2-acetamido-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 2413421 |
| Molecular Formula | C26H24F2N2O5 |
| Molecular Weight | 482.48 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | [2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] (Z)-2-acetamido-3-phenylprop-2-enoate |
| SMILES | CC(=O)N/C(=C\c1ccccc1)C(=O)OCC(=O)c1cc(C)n(-c2ccc(OC(F)F)cc2)c1C |
| InChI | InChI=1S/C26H24F2N2O5/c1-16-13-22(17(2)30(16)20-9-11-21(12-10-20)35-26(27)28)24(32)15-34-25(33)23(29-18(3)31)14-19-7-5-4-6-8-19/h4-14,26H,15H2,1-3H3,(H,29,31)/b23-14- |
| InChIKey | DEHVQIUPCIJDGW-UCQKPKSFSA-N |
| XLogP | 4.60 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.48 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|