C23H23F2N3O5 — CID 38850200
[2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetate (PubChem CID 38850200) has the molecular formula C23H23F2N3O5 and a molecular weight of 459.45 g/mol. Its IUPAC name is [2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetate.
| Compound Name | [2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetate |
|---|---|
| PubChem CID | 38850200 |
| Molecular Formula | C23H23F2N3O5 |
| Molecular Weight | 459.45 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | [2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetate |
| SMILES | Cc1nn(C)c(C)c1C(=O)C(=O)OCC(=O)c1cc(C)n(-c2ccc(OC(F)F)cc2)c1C |
| InChI | InChI=1S/C23H23F2N3O5/c1-12-10-18(14(3)28(12)16-6-8-17(9-7-16)33-23(24)25)19(29)11-32-22(31)21(30)20-13(2)26-27(5)15(20)4/h6-10,23H,11H2,1-5H3 |
| InChIKey | VGDHMIXRMZJLRN-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 92.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|