C20H18F2N4O4 — CID 41350883
[2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-aminopyrazine-2-carboxylate (PubChem CID 41350883) has the molecular formula C20H18F2N4O4 and a molecular weight of 416.38 g/mol. Its IUPAC name is [2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-aminopyrazine-2-carboxylate.
| Compound Name | [2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-aminopyrazine-2-carboxylate |
|---|---|
| PubChem CID | 41350883 |
| Molecular Formula | C20H18F2N4O4 |
| Molecular Weight | 416.38 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | [2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-aminopyrazine-2-carboxylate |
| SMILES | Cc1cc(C(=O)COC(=O)c2nccnc2N)c(C)n1-c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C20H18F2N4O4/c1-11-9-15(16(27)10-29-19(28)17-18(23)25-8-7-24-17)12(2)26(11)13-3-5-14(6-4-13)30-20(21)22/h3-9,20H,10H2,1-2H3,(H2,23,25) |
| InChIKey | RBOONVXWJPYRKX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|