C30H22F2N2O6 — CID 2411731
[2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 4-(1,3-dioxoisoindol-2-yl)benzoate (PubChem CID 2411731) has the molecular formula C30H22F2N2O6 and a molecular weight of 544.51 g/mol. Its IUPAC name is [2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 4-(1,3-dioxoisoindol-2-yl)benzoate.
| Compound Name | [2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 4-(1,3-dioxoisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 2411731 |
| Molecular Formula | C30H22F2N2O6 |
| Molecular Weight | 544.51 g/mol |
| Exact Mass | 544.14 |
| IUPAC Name | [2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 4-(1,3-dioxoisoindol-2-yl)benzoate |
| SMILES | Cc1cc(C(=O)COC(=O)c2ccc(N3C(=O)c4ccccc4C3=O)cc2)c(C)n1-c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C30H22F2N2O6/c1-17-15-25(18(2)33(17)20-11-13-22(14-12-20)40-30(31)32)26(35)16-39-29(38)19-7-9-21(10-8-19)34-27(36)23-5-3-4-6-24(23)28(34)37/h3-15,30H,16H2,1-2H3 |
| InChIKey | FFPUTBQYRLQZQG-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 94.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.51 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|