C26H23F2N3O5 — CID 2493539
[2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-ethyl-4-oxophthalazine-1-carboxylate (PubChem CID 2493539) has the molecular formula C26H23F2N3O5 and a molecular weight of 495.48 g/mol. Its IUPAC name is [2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-ethyl-4-oxophthalazine-1-carboxylate.
| Compound Name | [2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-ethyl-4-oxophthalazine-1-carboxylate |
|---|---|
| PubChem CID | 2493539 |
| Molecular Formula | C26H23F2N3O5 |
| Molecular Weight | 495.48 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | [2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-ethyl-4-oxophthalazine-1-carboxylate |
| SMILES | CCn1nc(C(=O)OCC(=O)c2cc(C)n(-c3ccc(OC(F)F)cc3)c2C)c2ccccc2c1=O |
| InChI | InChI=1S/C26H23F2N3O5/c1-4-30-24(33)20-8-6-5-7-19(20)23(29-30)25(34)35-14-22(32)21-13-15(2)31(16(21)3)17-9-11-18(12-10-17)36-26(27)28/h5-13,26H,4,14H2,1-3H3 |
| InChIKey | YXLNCTBJSTURMT-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 92.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|