C22H18F2N2O6 — CID 2453249
[2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-nitrobenzoate (PubChem CID 2453249) has the molecular formula C22H18F2N2O6 and a molecular weight of 444.39 g/mol. Its IUPAC name is [2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-nitrobenzoate.
| Compound Name | [2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-nitrobenzoate |
|---|---|
| PubChem CID | 2453249 |
| Molecular Formula | C22H18F2N2O6 |
| Molecular Weight | 444.39 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | [2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-nitrobenzoate |
| SMILES | Cc1cc(C(=O)COC(=O)c2ccccc2[N+](=O)[O-])c(C)n1-c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C22H18F2N2O6/c1-13-11-18(14(2)25(13)15-7-9-16(10-8-15)32-22(23)24)20(27)12-31-21(28)17-5-3-4-6-19(17)26(29)30/h3-11,22H,12H2,1-2H3 |
| InChIKey | INVUZIKWJWLSOR-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 100.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.39 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|