C22H19F2N3O5 — CID 16959247
1-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-[(E)-(3-nitrophenyl)methylideneamino]oxyethanone (PubChem CID 16959247) has the molecular formula C22H19F2N3O5 and a molecular weight of 443.41 g/mol. Its IUPAC name is 1-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-[(E)-(3-nitrophenyl)methylideneamino]oxyethanone.
| Compound Name | 1-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-[(E)-(3-nitrophenyl)methylideneamino]oxyethanone |
|---|---|
| PubChem CID | 16959247 |
| Molecular Formula | C22H19F2N3O5 |
| Molecular Weight | 443.41 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 1-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-[(E)-(3-nitrophenyl)methylideneamino]oxyethanone |
| SMILES | Cc1cc(C(=O)CO/N=C/c2cccc([N+](=O)[O-])c2)c(C)n1-c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C22H19F2N3O5/c1-14-10-20(15(2)26(14)17-6-8-19(9-7-17)32-22(23)24)21(28)13-31-25-12-16-4-3-5-18(11-16)27(29)30/h3-12,22H,13H2,1-2H3/b25-12+ |
| InChIKey | VABOSAVADRJRIG-BRJLIKDPSA-N |
| XLogP | 4.84 |
| TPSA | 95.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.41 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|