C22H19F2NO5 — CID 2398661
[2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] (E)-3-(furan-2-yl)prop-2-enoate (PubChem CID 2398661) has the molecular formula C22H19F2NO5 and a molecular weight of 415.39 g/mol. Its IUPAC name is [2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] (E)-3-(furan-2-yl)prop-2-enoate.
| Compound Name | [2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] (E)-3-(furan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 2398661 |
| Molecular Formula | C22H19F2NO5 |
| Molecular Weight | 415.39 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | [2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] (E)-3-(furan-2-yl)prop-2-enoate |
| SMILES | Cc1cc(C(=O)COC(=O)/C=C/c2ccco2)c(C)n1-c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C22H19F2NO5/c1-14-12-19(20(26)13-29-21(27)10-9-17-4-3-11-28-17)15(2)25(14)16-5-7-18(8-6-16)30-22(23)24/h3-12,22H,13H2,1-2H3/b10-9+ |
| InChIKey | LBORAKTYNPDNFF-MDZDMXLPSA-N |
| XLogP | 4.73 |
| TPSA | 70.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.39 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|