C21H18BrNO4 — CID 5033292
[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl] 3-(5-bromofuran-2-yl)prop-2-enoate (PubChem CID 5033292) has the molecular formula C21H18BrNO4 and a molecular weight of 428.28 g/mol. Its IUPAC name is [2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl] 3-(5-bromofuran-2-yl)prop-2-enoate.
| Compound Name | [2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl] 3-(5-bromofuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 5033292 |
| Molecular Formula | C21H18BrNO4 |
| Molecular Weight | 428.28 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | [2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl] 3-(5-bromofuran-2-yl)prop-2-enoate |
| SMILES | Cc1cc(C(=O)COC(=O)C=Cc2ccc(Br)o2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C21H18BrNO4/c1-14-12-18(15(2)23(14)16-6-4-3-5-7-16)19(24)13-26-21(25)11-9-17-8-10-20(22)27-17/h3-12H,13H2,1-2H3 |
| InChIKey | XJKDPXZTYAIQNU-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 61.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.28 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|