C20H22BrNO5 — CID 4658098
[2-[2,5-dimethyl-1-(oxolan-2-ylmethyl)pyrrol-3-yl]-2-oxoethyl] 3-(5-bromofuran-2-yl)prop-2-enoate (PubChem CID 4658098) has the molecular formula C20H22BrNO5 and a molecular weight of 436.30 g/mol. Its IUPAC name is [2-[2,5-dimethyl-1-(oxolan-2-ylmethyl)pyrrol-3-yl]-2-oxoethyl] 3-(5-bromofuran-2-yl)prop-2-enoate.
| Compound Name | [2-[2,5-dimethyl-1-(oxolan-2-ylmethyl)pyrrol-3-yl]-2-oxoethyl] 3-(5-bromofuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 4658098 |
| Molecular Formula | C20H22BrNO5 |
| Molecular Weight | 436.30 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | [2-[2,5-dimethyl-1-(oxolan-2-ylmethyl)pyrrol-3-yl]-2-oxoethyl] 3-(5-bromofuran-2-yl)prop-2-enoate |
| SMILES | Cc1cc(C(=O)COC(=O)C=Cc2ccc(Br)o2)c(C)n1CC1CCCO1 |
| InChI | InChI=1S/C20H22BrNO5/c1-13-10-17(14(2)22(13)11-16-4-3-9-25-16)18(23)12-26-20(24)8-6-15-5-7-19(21)27-15/h5-8,10,16H,3-4,9,11-12H2,1-2H3 |
| InChIKey | DTZSJCZTSVMHGF-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 70.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.30 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|