C23H22BrNO4 — CID 4692333
[2-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-(5-bromofuran-2-yl)prop-2-enoate (PubChem CID 4692333) has the molecular formula C23H22BrNO4 and a molecular weight of 456.34 g/mol. Its IUPAC name is [2-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-(5-bromofuran-2-yl)prop-2-enoate.
| Compound Name | [2-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-(5-bromofuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 4692333 |
| Molecular Formula | C23H22BrNO4 |
| Molecular Weight | 456.34 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | [2-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-(5-bromofuran-2-yl)prop-2-enoate |
| SMILES | Cc1ccc(-n2c(C)cc(C(=O)COC(=O)C=Cc3ccc(Br)o3)c2C)cc1C |
| InChI | InChI=1S/C23H22BrNO4/c1-14-5-6-18(11-15(14)2)25-16(3)12-20(17(25)4)21(26)13-28-23(27)10-8-19-7-9-22(24)29-19/h5-12H,13H2,1-4H3 |
| InChIKey | GCLDRWACZRGNNG-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 61.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.34 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|