C30H30ClN3O3 — CID 2394447
[2-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] (E)-3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoate (PubChem CID 2394447) has the molecular formula C30H30ClN3O3 and a molecular weight of 516.04 g/mol. Its IUPAC name is [2-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] (E)-3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoate.
| Compound Name | [2-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] (E)-3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 2394447 |
| Molecular Formula | C30H30ClN3O3 |
| Molecular Weight | 516.04 g/mol |
| Exact Mass | 515.20 |
| IUPAC Name | [2-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] (E)-3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoate |
| SMILES | Cc1ccc(-n2c(C)cc(C(=O)COC(=O)/C=C/c3c(C)nn(Cc4ccccc4)c3Cl)c2C)cc1C |
| InChI | InChI=1S/C30H30ClN3O3/c1-19-11-12-25(15-20(19)2)34-21(3)16-27(23(34)5)28(35)18-37-29(36)14-13-26-22(4)32-33(30(26)31)17-24-9-7-6-8-10-24/h6-16H,17-18H2,1-5H3/b14-13+ |
| InChIKey | AUQJIDXSTRCSTQ-BUHFOSPRSA-N |
| XLogP | 6.36 |
| TPSA | 66.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.04 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|