C23H22ClN3O3 — CID 2096033
[2-(benzylamino)-2-oxoethyl] (E)-3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoate (PubChem CID 2096033) has the molecular formula C23H22ClN3O3 and a molecular weight of 423.90 g/mol. Its IUPAC name is [2-(benzylamino)-2-oxoethyl] (E)-3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoate.
| Compound Name | [2-(benzylamino)-2-oxoethyl] (E)-3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 2096033 |
| Molecular Formula | C23H22ClN3O3 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | [2-(benzylamino)-2-oxoethyl] (E)-3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoate |
| SMILES | Cc1nn(Cc2ccccc2)c(Cl)c1/C=C/C(=O)OCC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C23H22ClN3O3/c1-17-20(23(24)27(26-17)15-19-10-6-3-7-11-19)12-13-22(29)30-16-21(28)25-14-18-8-4-2-5-9-18/h2-13H,14-16H2,1H3,(H,25,28)/b13-12+ |
| InChIKey | ZNRCBDPZQUAGQZ-OUKQBFOZSA-N |
| XLogP | 3.77 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|