C23H21ClN4O5 — CID 29344423
[2-(2-methyl-6-nitroanilino)-2-oxoethyl] (E)-3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoate (PubChem CID 29344423) has the molecular formula C23H21ClN4O5 and a molecular weight of 468.90 g/mol. Its IUPAC name is [2-(2-methyl-6-nitroanilino)-2-oxoethyl] (E)-3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoate.
| Compound Name | [2-(2-methyl-6-nitroanilino)-2-oxoethyl] (E)-3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 29344423 |
| Molecular Formula | C23H21ClN4O5 |
| Molecular Weight | 468.90 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | [2-(2-methyl-6-nitroanilino)-2-oxoethyl] (E)-3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoate |
| SMILES | Cc1cccc([N+](=O)[O-])c1NC(=O)COC(=O)/C=C/c1c(C)nn(Cc2ccccc2)c1Cl |
| InChI | InChI=1S/C23H21ClN4O5/c1-15-7-6-10-19(28(31)32)22(15)25-20(29)14-33-21(30)12-11-18-16(2)26-27(23(18)24)13-17-8-4-3-5-9-17/h3-12H,13-14H2,1-2H3,(H,25,29)/b12-11+ |
| InChIKey | BSYFOPBRDYMFLT-VAWYXSNFSA-N |
| XLogP | 4.30 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.90 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|