C25H25ClN4O5 — CID 31128153
[2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl] (E)-3-[5-chloro-3-methyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]prop-2-enoate (PubChem CID 31128153) has the molecular formula C25H25ClN4O5 and a molecular weight of 496.95 g/mol. Its IUPAC name is [2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl] (E)-3-[5-chloro-3-methyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]prop-2-enoate.
| Compound Name | [2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl] (E)-3-[5-chloro-3-methyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 31128153 |
| Molecular Formula | C25H25ClN4O5 |
| Molecular Weight | 496.95 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | [2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl] (E)-3-[5-chloro-3-methyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]prop-2-enoate |
| SMILES | Cc1ccc(Cn2nc(C)c(/C=C/C(=O)OCC(=O)Nc3c([N+](=O)[O-])ccc(C)c3C)c2Cl)cc1 |
| InChI | InChI=1S/C25H25ClN4O5/c1-15-5-8-19(9-6-15)13-29-25(26)20(18(4)28-29)10-12-23(32)35-14-22(31)27-24-17(3)16(2)7-11-21(24)30(33)34/h5-12H,13-14H2,1-4H3,(H,27,31)/b12-10+ |
| InChIKey | JRKPYLNZLVFXHJ-ZRDIBKRKSA-N |
| XLogP | 4.92 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.95 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|