C14H16N2O5 — CID 8759430
[2-(2-methyl-6-nitroanilino)-2-oxoethyl] 3-methylbut-2-enoate (PubChem CID 8759430) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is [2-(2-methyl-6-nitroanilino)-2-oxoethyl] 3-methylbut-2-enoate.
| Compound Name | [2-(2-methyl-6-nitroanilino)-2-oxoethyl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 8759430 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | [2-(2-methyl-6-nitroanilino)-2-oxoethyl] 3-methylbut-2-enoate |
| SMILES | CC(C)=CC(=O)OCC(=O)Nc1c(C)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H16N2O5/c1-9(2)7-13(18)21-8-12(17)15-14-10(3)5-4-6-11(14)16(19)20/h4-7H,8H2,1-3H3,(H,15,17) |
| InChIKey | SWAZJRXPFPWCHL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|