C14H16N2O5 — CID 7776755
trans-[2-(2-methyl-6-nitroanilino)-2-oxoethyl] (1S,2S)-2-methylcyclopropane-1-carboxylate (PubChem CID 7776755) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is trans-[2-(2-methyl-6-nitroanilino)-2-oxoethyl] (1S,2S)-2-methylcyclopropane-1-carboxylate.
| Compound Name | trans-[2-(2-methyl-6-nitroanilino)-2-oxoethyl] (1S,2S)-2-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 7776755 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | trans-[2-(2-methyl-6-nitroanilino)-2-oxoethyl] (1S,2S)-2-methylcyclopropane-1-carboxylate |
| SMILES | Cc1cccc([N+](=O)[O-])c1NC(=O)COC(=O)[C@H]1C[C@@H]1C |
| InChI | InChI=1S/C14H16N2O5/c1-8-4-3-5-11(16(19)20)13(8)15-12(17)7-21-14(18)10-6-9(10)2/h3-5,9-10H,6-7H2,1-2H3,(H,15,17)/t9-,10-/m0/s1 |
| InChIKey | MFNULQFCBONESU-UWVGGRQHSA-N |
| XLogP | 2.04 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|