C21H18ClFN2O2 — CID 7913948
(4-fluorophenyl)methyl (E)-3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoate (PubChem CID 7913948) has the molecular formula C21H18ClFN2O2 and a molecular weight of 384.84 g/mol. Its IUPAC name is (4-fluorophenyl)methyl (E)-3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoate.
| Compound Name | (4-fluorophenyl)methyl (E)-3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7913948 |
| Molecular Formula | C21H18ClFN2O2 |
| Molecular Weight | 384.84 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | (4-fluorophenyl)methyl (E)-3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoate |
| SMILES | Cc1nn(Cc2ccccc2)c(Cl)c1/C=C/C(=O)OCc1ccc(F)cc1 |
| InChI | InChI=1S/C21H18ClFN2O2/c1-15-19(21(22)25(24-15)13-16-5-3-2-4-6-16)11-12-20(26)27-14-17-7-9-18(23)10-8-17/h2-12H,13-14H2,1H3/b12-11+ |
| InChIKey | PUSZCYAGYAXFFV-VAWYXSNFSA-N |
| XLogP | 4.79 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.84 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|