C22H17ClF2N2O3 — CID 29396663
[2-(2,5-difluorophenyl)-2-oxoethyl] (E)-3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoate (PubChem CID 29396663) has the molecular formula C22H17ClF2N2O3 and a molecular weight of 430.84 g/mol. Its IUPAC name is [2-(2,5-difluorophenyl)-2-oxoethyl] (E)-3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoate.
| Compound Name | [2-(2,5-difluorophenyl)-2-oxoethyl] (E)-3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 29396663 |
| Molecular Formula | C22H17ClF2N2O3 |
| Molecular Weight | 430.84 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | [2-(2,5-difluorophenyl)-2-oxoethyl] (E)-3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoate |
| SMILES | Cc1nn(Cc2ccccc2)c(Cl)c1/C=C/C(=O)OCC(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C22H17ClF2N2O3/c1-14-17(22(23)27(26-14)12-15-5-3-2-4-6-15)8-10-21(29)30-13-20(28)18-11-16(24)7-9-19(18)25/h2-11H,12-13H2,1H3/b10-8+ |
| InChIKey | MCGCGKDVABFKDO-CSKARUKUSA-N |
| XLogP | 4.61 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.84 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|