C22H18Cl2N2O3 — CID 4289191
phenacyl 3-[5-chloro-1-[(2-chlorophenyl)methyl]-3-methylpyrazol-4-yl]prop-2-enoate (PubChem CID 4289191) has the molecular formula C22H18Cl2N2O3 and a molecular weight of 429.30 g/mol. Its IUPAC name is phenacyl 3-[5-chloro-1-[(2-chlorophenyl)methyl]-3-methylpyrazol-4-yl]prop-2-enoate.
| Compound Name | phenacyl 3-[5-chloro-1-[(2-chlorophenyl)methyl]-3-methylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 4289191 |
| Molecular Formula | C22H18Cl2N2O3 |
| Molecular Weight | 429.30 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | phenacyl 3-[5-chloro-1-[(2-chlorophenyl)methyl]-3-methylpyrazol-4-yl]prop-2-enoate |
| SMILES | Cc1nn(Cc2ccccc2Cl)c(Cl)c1C=CC(=O)OCC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H18Cl2N2O3/c1-15-18(22(24)26(25-15)13-17-9-5-6-10-19(17)23)11-12-21(28)29-14-20(27)16-7-3-2-4-8-16/h2-12H,13-14H2,1H3 |
| InChIKey | RYEXSIQZRCRZFP-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.30 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|