C27H28ClN3O5S — CID 2412940
[2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] (E)-3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoate (PubChem CID 2412940) has the molecular formula C27H28ClN3O5S and a molecular weight of 542.06 g/mol. Its IUPAC name is [2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] (E)-3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoate.
| Compound Name | [2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] (E)-3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 2412940 |
| Molecular Formula | C27H28ClN3O5S |
| Molecular Weight | 542.06 g/mol |
| Exact Mass | 541.14 |
| IUPAC Name | [2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] (E)-3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoate |
| SMILES | Cc1nn(Cc2ccccc2)c(Cl)c1/C=C/C(=O)OCC(=O)c1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C27H28ClN3O5S/c1-20-24(27(28)31(29-20)18-21-8-4-2-5-9-21)14-15-26(33)36-19-25(32)22-10-12-23(13-11-22)37(34,35)30-16-6-3-7-17-30/h2,4-5,8-15H,3,6-7,16-19H2,1H3/b15-14+ |
| InChIKey | MCHWFUQGTDVYIQ-CCEZHUSRSA-N |
| XLogP | 4.51 |
| TPSA | 98.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.06 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|