C21H16Cl4N2O2 — CID 3922739
(2,6-dichlorophenyl)methyl 3-[5-chloro-1-[(2-chlorophenyl)methyl]-3-methylpyrazol-4-yl]prop-2-enoate (PubChem CID 3922739) has the molecular formula C21H16Cl4N2O2 and a molecular weight of 470.18 g/mol. Its IUPAC name is (2,6-dichlorophenyl)methyl 3-[5-chloro-1-[(2-chlorophenyl)methyl]-3-methylpyrazol-4-yl]prop-2-enoate.
| Compound Name | (2,6-dichlorophenyl)methyl 3-[5-chloro-1-[(2-chlorophenyl)methyl]-3-methylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 3922739 |
| Molecular Formula | C21H16Cl4N2O2 |
| Molecular Weight | 470.18 g/mol |
| Exact Mass | 468.00 |
| IUPAC Name | (2,6-dichlorophenyl)methyl 3-[5-chloro-1-[(2-chlorophenyl)methyl]-3-methylpyrazol-4-yl]prop-2-enoate |
| SMILES | Cc1nn(Cc2ccccc2Cl)c(Cl)c1C=CC(=O)OCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C21H16Cl4N2O2/c1-13-15(21(25)27(26-13)11-14-5-2-3-6-17(14)22)9-10-20(28)29-12-16-18(23)7-4-8-19(16)24/h2-10H,11-12H2,1H3 |
| InChIKey | ZBLMQEYTFBQDBZ-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.18 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|