C17H15BrO6 — CID 7627667
[2-(2,5-dimethoxyphenyl)-2-oxoethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate (PubChem CID 7627667) has the molecular formula C17H15BrO6 and a molecular weight of 395.21 g/mol. Its IUPAC name is [2-(2,5-dimethoxyphenyl)-2-oxoethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate.
| Compound Name | [2-(2,5-dimethoxyphenyl)-2-oxoethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7627667 |
| Molecular Formula | C17H15BrO6 |
| Molecular Weight | 395.21 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | [2-(2,5-dimethoxyphenyl)-2-oxoethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
| SMILES | COc1ccc(OC)c(C(=O)COC(=O)/C=C/c2ccc(Br)o2)c1 |
| InChI | InChI=1S/C17H15BrO6/c1-21-12-3-6-15(22-2)13(9-12)14(19)10-23-17(20)8-5-11-4-7-16(18)24-11/h3-9H,10H2,1-2H3/b8-5+ |
| InChIKey | ILXKBDNJRVBOIU-VMPITWQZSA-N |
| XLogP | 3.50 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.21 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|