C20H20O6 — CID 4008524
[2-(2,4-dimethoxyphenyl)-2-oxoethyl] 3-(4-methoxyphenyl)prop-2-enoate (PubChem CID 4008524) has the molecular formula C20H20O6 and a molecular weight of 356.37 g/mol. Its IUPAC name is [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 3-(4-methoxyphenyl)prop-2-enoate.
| Compound Name | [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 3-(4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 4008524 |
| Molecular Formula | C20H20O6 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 3-(4-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(C=CC(=O)OCC(=O)c2ccc(OC)cc2OC)cc1 |
| InChI | InChI=1S/C20H20O6/c1-23-15-7-4-14(5-8-15)6-11-20(22)26-13-18(21)17-10-9-16(24-2)12-19(17)25-3/h4-12H,13H2,1-3H3 |
| InChIKey | IMERDIGTJPYBIQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|