C22H16F2O4 — CID 8517232
[2-(2,5-difluorophenyl)-2-oxoethyl] (E)-3-(6-methoxynaphthalen-2-yl)prop-2-enoate (PubChem CID 8517232) has the molecular formula C22H16F2O4 and a molecular weight of 382.36 g/mol. Its IUPAC name is [2-(2,5-difluorophenyl)-2-oxoethyl] (E)-3-(6-methoxynaphthalen-2-yl)prop-2-enoate.
| Compound Name | [2-(2,5-difluorophenyl)-2-oxoethyl] (E)-3-(6-methoxynaphthalen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8517232 |
| Molecular Formula | C22H16F2O4 |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | [2-(2,5-difluorophenyl)-2-oxoethyl] (E)-3-(6-methoxynaphthalen-2-yl)prop-2-enoate |
| SMILES | COc1ccc2cc(/C=C/C(=O)OCC(=O)c3cc(F)ccc3F)ccc2c1 |
| InChI | InChI=1S/C22H16F2O4/c1-27-18-7-5-15-10-14(2-4-16(15)11-18)3-9-22(26)28-13-21(25)19-12-17(23)6-8-20(19)24/h2-12H,13H2,1H3/b9-3+ |
| InChIKey | FUSNYIAALAKHNN-YCRREMRBSA-N |
| XLogP | 4.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|