C17H16O6 — CID 3977727
[2-(2,4-dimethoxyphenyl)-2-oxoethyl] 3-(furan-2-yl)prop-2-enoate (PubChem CID 3977727) has the molecular formula C17H16O6 and a molecular weight of 316.31 g/mol. Its IUPAC name is [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 3-(furan-2-yl)prop-2-enoate.
| Compound Name | [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 3-(furan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 3977727 |
| Molecular Formula | C17H16O6 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 3-(furan-2-yl)prop-2-enoate |
| SMILES | COc1ccc(C(=O)COC(=O)C=Cc2ccco2)c(OC)c1 |
| InChI | InChI=1S/C17H16O6/c1-20-13-5-7-14(16(10-13)21-2)15(18)11-23-17(19)8-6-12-4-3-9-22-12/h3-10H,11H2,1-2H3 |
| InChIKey | UAIRQCXSCQKJDP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|