C23H24N2O3 — CID 7931311
4-[2-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethoxy]benzamide (PubChem CID 7931311) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is 4-[2-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethoxy]benzamide.
| Compound Name | 4-[2-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 7931311 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 4-[2-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethoxy]benzamide |
| SMILES | Cc1ccc(-n2c(C)cc(C(=O)COc3ccc(C(N)=O)cc3)c2C)cc1C |
| InChI | InChI=1S/C23H24N2O3/c1-14-5-8-19(11-15(14)2)25-16(3)12-21(17(25)4)22(26)13-28-20-9-6-18(7-10-20)23(24)27/h5-12H,13H2,1-4H3,(H2,24,27) |
| InChIKey | PFWDAXNQTGUIGN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|