C27H32N2O5S — CID 4854094
[2-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 4-(diethylsulfamoyl)benzoate (PubChem CID 4854094) has the molecular formula C27H32N2O5S and a molecular weight of 496.63 g/mol. Its IUPAC name is [2-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 4-(diethylsulfamoyl)benzoate.
| Compound Name | [2-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 4-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 4854094 |
| Molecular Formula | C27H32N2O5S |
| Molecular Weight | 496.63 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | [2-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 4-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)OCC(=O)c2cc(C)n(-c3ccc(C)c(C)c3)c2C)cc1 |
| InChI | InChI=1S/C27H32N2O5S/c1-7-28(8-2)35(32,33)24-13-10-22(11-14-24)27(31)34-17-26(30)25-16-20(5)29(21(25)6)23-12-9-18(3)19(4)15-23/h9-16H,7-8,17H2,1-6H3 |
| InChIKey | PDMGJDXEIHATMG-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.63 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|