C25H25N3O6S — CID 42985097
[2-[2,5-dimethyl-1-(4-sulfamoylphenyl)pyrrol-3-yl]-2-oxoethyl] 4-(2-oxopyrrolidin-1-yl)benzoate (PubChem CID 42985097) has the molecular formula C25H25N3O6S and a molecular weight of 495.56 g/mol. Its IUPAC name is [2-[2,5-dimethyl-1-(4-sulfamoylphenyl)pyrrol-3-yl]-2-oxoethyl] 4-(2-oxopyrrolidin-1-yl)benzoate.
| Compound Name | [2-[2,5-dimethyl-1-(4-sulfamoylphenyl)pyrrol-3-yl]-2-oxoethyl] 4-(2-oxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 42985097 |
| Molecular Formula | C25H25N3O6S |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | [2-[2,5-dimethyl-1-(4-sulfamoylphenyl)pyrrol-3-yl]-2-oxoethyl] 4-(2-oxopyrrolidin-1-yl)benzoate |
| SMILES | Cc1cc(C(=O)COC(=O)c2ccc(N3CCCC3=O)cc2)c(C)n1-c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C25H25N3O6S/c1-16-14-22(17(2)28(16)20-9-11-21(12-10-20)35(26,32)33)23(29)15-34-25(31)18-5-7-19(8-6-18)27-13-3-4-24(27)30/h5-12,14H,3-4,13,15H2,1-2H3,(H2,26,32,33) |
| InChIKey | AWMCYIWFISRUBR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 128.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|