C24H24N2O7S — CID 42983950
[2-[1-(4-methoxycarbonylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-methyl-5-sulfamoylbenzoate (PubChem CID 42983950) has the molecular formula C24H24N2O7S and a molecular weight of 484.53 g/mol. Its IUPAC name is [2-[1-(4-methoxycarbonylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-methyl-5-sulfamoylbenzoate.
| Compound Name | [2-[1-(4-methoxycarbonylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-methyl-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 42983950 |
| Molecular Formula | C24H24N2O7S |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | [2-[1-(4-methoxycarbonylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-methyl-5-sulfamoylbenzoate |
| SMILES | COC(=O)c1ccc(-n2c(C)cc(C(=O)COC(=O)c3cc(S(N)(=O)=O)ccc3C)c2C)cc1 |
| InChI | InChI=1S/C24H24N2O7S/c1-14-5-10-19(34(25,30)31)12-20(14)24(29)33-13-22(27)21-11-15(2)26(16(21)3)18-8-6-17(7-9-18)23(28)32-4/h5-12H,13H2,1-4H3,(H2,25,30,31) |
| InChIKey | SOHXTQSCOVSYIZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 134.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|