C19H19N5O5S — CID 41350880
[2-[2,5-dimethyl-1-(4-sulfamoylphenyl)pyrrol-3-yl]-2-oxoethyl] 3-aminopyrazine-2-carboxylate (PubChem CID 41350880) has the molecular formula C19H19N5O5S and a molecular weight of 429.46 g/mol. Its IUPAC name is [2-[2,5-dimethyl-1-(4-sulfamoylphenyl)pyrrol-3-yl]-2-oxoethyl] 3-aminopyrazine-2-carboxylate.
| Compound Name | [2-[2,5-dimethyl-1-(4-sulfamoylphenyl)pyrrol-3-yl]-2-oxoethyl] 3-aminopyrazine-2-carboxylate |
|---|---|
| PubChem CID | 41350880 |
| Molecular Formula | C19H19N5O5S |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | [2-[2,5-dimethyl-1-(4-sulfamoylphenyl)pyrrol-3-yl]-2-oxoethyl] 3-aminopyrazine-2-carboxylate |
| SMILES | Cc1cc(C(=O)COC(=O)c2nccnc2N)c(C)n1-c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C19H19N5O5S/c1-11-9-15(16(25)10-29-19(26)17-18(20)23-8-7-22-17)12(2)24(11)13-3-5-14(6-4-13)30(21,27)28/h3-9H,10H2,1-2H3,(H2,20,23)(H2,21,27,28) |
| InChIKey | VPFFBUBADLWBCG-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 160.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|