C21H19N5O5S — CID 166205481
[2-[2,5-dimethyl-1-(4-sulfamoylphenyl)pyrrol-3-yl]-2-oxoethyl] pyrazolo[1,5-a]pyrimidine-3-carboxylate (PubChem CID 166205481) has the molecular formula C21H19N5O5S and a molecular weight of 453.48 g/mol. Its IUPAC name is [2-[2,5-dimethyl-1-(4-sulfamoylphenyl)pyrrol-3-yl]-2-oxoethyl] pyrazolo[1,5-a]pyrimidine-3-carboxylate.
| Compound Name | [2-[2,5-dimethyl-1-(4-sulfamoylphenyl)pyrrol-3-yl]-2-oxoethyl] pyrazolo[1,5-a]pyrimidine-3-carboxylate |
|---|---|
| PubChem CID | 166205481 |
| Molecular Formula | C21H19N5O5S |
| Molecular Weight | 453.48 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | [2-[2,5-dimethyl-1-(4-sulfamoylphenyl)pyrrol-3-yl]-2-oxoethyl] pyrazolo[1,5-a]pyrimidine-3-carboxylate |
| SMILES | Cc1cc(C(=O)COC(=O)c2cnn3cccnc23)c(C)n1-c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C21H19N5O5S/c1-13-10-17(14(2)26(13)15-4-6-16(7-5-15)32(22,29)30)19(27)12-31-21(28)18-11-24-25-9-3-8-23-20(18)25/h3-11H,12H2,1-2H3,(H2,22,29,30) |
| InChIKey | CCYALZXIAJTQBM-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 138.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.48 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|