C20H17BrN2O3 — CID 3630921
[2-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] pyridine-2-carboxylate (PubChem CID 3630921) has the molecular formula C20H17BrN2O3 and a molecular weight of 413.27 g/mol. Its IUPAC name is [2-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] pyridine-2-carboxylate.
| Compound Name | [2-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] pyridine-2-carboxylate |
|---|---|
| PubChem CID | 3630921 |
| Molecular Formula | C20H17BrN2O3 |
| Molecular Weight | 413.27 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | [2-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] pyridine-2-carboxylate |
| SMILES | Cc1cc(C(=O)COC(=O)c2ccccn2)c(C)n1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H17BrN2O3/c1-13-11-17(14(2)23(13)16-8-6-15(21)7-9-16)19(24)12-26-20(25)18-5-3-4-10-22-18/h3-11H,12H2,1-2H3 |
| InChIKey | YYOQARRVQPNYTP-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.27 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|