C23H24N2O3 — CID 7776708
[2-[2,5-dimethyl-1-(4-propan-2-ylphenyl)pyrrol-3-yl]-2-oxoethyl] pyridine-2-carboxylate (PubChem CID 7776708) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is [2-[2,5-dimethyl-1-(4-propan-2-ylphenyl)pyrrol-3-yl]-2-oxoethyl] pyridine-2-carboxylate.
| Compound Name | [2-[2,5-dimethyl-1-(4-propan-2-ylphenyl)pyrrol-3-yl]-2-oxoethyl] pyridine-2-carboxylate |
|---|---|
| PubChem CID | 7776708 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | [2-[2,5-dimethyl-1-(4-propan-2-ylphenyl)pyrrol-3-yl]-2-oxoethyl] pyridine-2-carboxylate |
| SMILES | Cc1cc(C(=O)COC(=O)c2ccccn2)c(C)n1-c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C23H24N2O3/c1-15(2)18-8-10-19(11-9-18)25-16(3)13-20(17(25)4)22(26)14-28-23(27)21-7-5-6-12-24-21/h5-13,15H,14H2,1-4H3 |
| InChIKey | XCZVKAJRONQBLO-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|