C26H29NO4 — CID 18270260
2-(4-acetyl-2-methoxyphenoxy)-1-[2,5-dimethyl-1-(4-propan-2-ylphenyl)pyrrol-3-yl]ethanone (PubChem CID 18270260) has the molecular formula C26H29NO4 and a molecular weight of 419.52 g/mol. Its IUPAC name is 2-(4-acetyl-2-methoxyphenoxy)-1-[2,5-dimethyl-1-(4-propan-2-ylphenyl)pyrrol-3-yl]ethanone.
| Compound Name | 2-(4-acetyl-2-methoxyphenoxy)-1-[2,5-dimethyl-1-(4-propan-2-ylphenyl)pyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 18270260 |
| Molecular Formula | C26H29NO4 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 2-(4-acetyl-2-methoxyphenoxy)-1-[2,5-dimethyl-1-(4-propan-2-ylphenyl)pyrrol-3-yl]ethanone |
| SMILES | COc1cc(C(C)=O)ccc1OCC(=O)c1cc(C)n(-c2ccc(C(C)C)cc2)c1C |
| InChI | InChI=1S/C26H29NO4/c1-16(2)20-7-10-22(11-8-20)27-17(3)13-23(18(27)4)24(29)15-31-25-12-9-21(19(5)28)14-26(25)30-6/h7-14,16H,15H2,1-6H3 |
| InChIKey | MAYYXLNPVBXNDS-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|