C24H24FNO4 — CID 4782450
2-[4-acetyl-2-(methoxymethyl)phenoxy]-1-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]ethanone (PubChem CID 4782450) has the molecular formula C24H24FNO4 and a molecular weight of 409.46 g/mol. Its IUPAC name is 2-[4-acetyl-2-(methoxymethyl)phenoxy]-1-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]ethanone.
| Compound Name | 2-[4-acetyl-2-(methoxymethyl)phenoxy]-1-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 4782450 |
| Molecular Formula | C24H24FNO4 |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 2-[4-acetyl-2-(methoxymethyl)phenoxy]-1-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]ethanone |
| SMILES | COCc1cc(C(C)=O)ccc1OCC(=O)c1cc(C)n(-c2ccccc2F)c1C |
| InChI | InChI=1S/C24H24FNO4/c1-15-11-20(16(2)26(15)22-8-6-5-7-21(22)25)23(28)14-30-24-10-9-18(17(3)27)12-19(24)13-29-4/h5-12H,13-14H2,1-4H3 |
| InChIKey | UZHIZGPOVAMTAV-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|