C22H21F2N3O3 — CID 55543848
N'-[2-(2-fluorophenoxy)propanoyl]-1-(2-fluorophenyl)-2,5-dimethylpyrrole-3-carbohydrazide (PubChem CID 55543848) has the molecular formula C22H21F2N3O3 and a molecular weight of 413.42 g/mol. Its IUPAC name is N'-[2-(2-fluorophenoxy)propanoyl]-1-(2-fluorophenyl)-2,5-dimethylpyrrole-3-carbohydrazide.
| Compound Name | N'-[2-(2-fluorophenoxy)propanoyl]-1-(2-fluorophenyl)-2,5-dimethylpyrrole-3-carbohydrazide |
|---|---|
| PubChem CID | 55543848 |
| Molecular Formula | C22H21F2N3O3 |
| Molecular Weight | 413.42 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | N'-[2-(2-fluorophenoxy)propanoyl]-1-(2-fluorophenyl)-2,5-dimethylpyrrole-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)C(C)Oc2ccccc2F)c(C)n1-c1ccccc1F |
| InChI | InChI=1S/C22H21F2N3O3/c1-13-12-16(14(2)27(13)19-10-6-4-8-17(19)23)22(29)26-25-21(28)15(3)30-20-11-7-5-9-18(20)24/h4-12,15H,1-3H3,(H,25,28)(H,26,29) |
| InChIKey | BXGCLRDLGUTECY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|